Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Imidazole, >98.5% (Dry Basis), Ultrapure
CAS: 288-32-4 Molecular Formula: C3H4N2 Molecular Weight (g/mol): 68.08 MDL Number: MFCD00005183 InChI Key: RAXXELZNTBOGNW-UHFFFAOYSA-N Synonym: imidazole,glyoxaline,imidazol,iminazole,miazole,1,3-diazole,glyoxalin,imutex,1,3-diaza-2,4-cyclopentadiene,pyrro b monazole PubChem CID: 795 ChEBI: CHEBI:16069 IUPAC Name: 1 H-imidazole SMILES: N1C=CN=C1
| PubChem CID | 795 |
|---|---|
| CAS | 288-32-4 |
| Molecular Weight (g/mol) | 68.08 |
| ChEBI | CHEBI:16069 |
| MDL Number | MFCD00005183 |
| SMILES | N1C=CN=C1 |
| Synonym | imidazole,glyoxaline,imidazol,iminazole,miazole,1,3-diazole,glyoxalin,imutex,1,3-diaza-2,4-cyclopentadiene,pyrro b monazole |
| IUPAC Name | 1 H-imidazole |
| InChI Key | RAXXELZNTBOGNW-UHFFFAOYSA-N |
| Molecular Formula | C3H4N2 |
Thermo Scientific Chemicals Dextran Sulfate Sodium Salt
CAS: 9011-18-1 Molecular Formula: (C6H7O5)m(C6H7O5)n Molecular Weight (g/mol): 500,000 MDL Number: MFCD00081551 InChI Key: BLFLLBZGZJTVJG-UHFFFAOYSA-N Synonym: benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin PubChem CID: 2337 ChEBI: CHEBI:116735 IUPAC Name: Dextran sulfate sodium salt SMILES: *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*]
| PubChem CID | 2337 |
|---|---|
| CAS | 9011-18-1 |
| Molecular Weight (g/mol) | 500,000 |
| ChEBI | CHEBI:116735 |
| MDL Number | MFCD00081551 |
| SMILES | *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*] |
| Synonym | benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin |
| IUPAC Name | Dextran sulfate sodium salt |
| InChI Key | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Molecular Formula | (C6H7O5)m(C6H7O5)n |
Cyclohexene oxide, 98%
CAS: 286-20-4 Molecular Formula: C6H10O Molecular Weight (g/mol): 98.14 MDL Number: MFCD00005162 InChI Key: ZWAJLVLEBYIOTI-UHFFFAOYSA-N Synonym: cyclohexene oxide,7-oxabicyclo 4.1.0 heptane,1,2-epoxycyclohexane,cyclohexene epoxide,cyclohexylene oxide,tetramethyleneoxirane,cyclohexene 1-oxide,epoxycyclohexane,cyclohexeneoxide,1,2-cyclohexene oxide PubChem CID: 9246 IUPAC Name: 7-oxabicyclo[4.1.0]heptane SMILES: C1CCC2C(C1)O2
| PubChem CID | 9246 |
|---|---|
| CAS | 286-20-4 |
| Molecular Weight (g/mol) | 98.14 |
| MDL Number | MFCD00005162 |
| SMILES | C1CCC2C(C1)O2 |
| Synonym | cyclohexene oxide,7-oxabicyclo 4.1.0 heptane,1,2-epoxycyclohexane,cyclohexene epoxide,cyclohexylene oxide,tetramethyleneoxirane,cyclohexene 1-oxide,epoxycyclohexane,cyclohexeneoxide,1,2-cyclohexene oxide |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptane |
| InChI Key | ZWAJLVLEBYIOTI-UHFFFAOYSA-N |
| Molecular Formula | C6H10O |
3-Aminophthalhydrazide, 98%, pure
CAS: 521-31-3 Molecular Formula: C8H7N3O2 Molecular Weight (g/mol): 177.16 MDL Number: MFCD00006890 InChI Key: HWYHZTIRURJOHG-UHFFFAOYSA-N Synonym: luminol,3-aminophthalhydrazide,3-aminophthalic hydrazide,5-amino-2,3-dihydro-1,4-phthalazinedione,1,4-phthalazinedione, 5-amino-2,3-dihydro,3-aminophthalic acid hydrazide,5-amino-1,2,3,4-tetrahydrophthalazine-1,4-dione,unii-5exp385q4f,ccris 5962,3-aminophthalylhydrazide PubChem CID: 10638 IUPAC Name: 5-amino-2,3-dihydrophthalazine-1,4-dione SMILES: C1=CC2=C(C(=C1)N)C(=O)NNC2=O
| PubChem CID | 10638 |
|---|---|
| CAS | 521-31-3 |
| Molecular Weight (g/mol) | 177.16 |
| MDL Number | MFCD00006890 |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)NNC2=O |
| Synonym | luminol,3-aminophthalhydrazide,3-aminophthalic hydrazide,5-amino-2,3-dihydro-1,4-phthalazinedione,1,4-phthalazinedione, 5-amino-2,3-dihydro,3-aminophthalic acid hydrazide,5-amino-1,2,3,4-tetrahydrophthalazine-1,4-dione,unii-5exp385q4f,ccris 5962,3-aminophthalylhydrazide |
| IUPAC Name | 5-amino-2,3-dihydrophthalazine-1,4-dione |
| InChI Key | HWYHZTIRURJOHG-UHFFFAOYSA-N |
| Molecular Formula | C8H7N3O2 |
Ethanesulfonic acid, 96%
CAS: 594-45-6 Molecular Formula: C2H5O3S Molecular Weight (g/mol): 109.12 MDL Number: MFCD00007529 InChI Key: CCIVGXIOQKPBKL-UHFFFAOYSA-M Synonym: ethylsulfonic acid,ethanesulphonic acid,ethane sulfonate,ethane sulfonic acid,ethane sulphonic acid,ethansulfonic acid,ethylsulphonic acid,1-ethanesulfonic acid,2-ethanesulfonic acid,ethanesulfonicacid PubChem CID: 11668 ChEBI: CHEBI:42465 IUPAC Name: ethanesulfonic acid SMILES: CCS([O-])(=O)=O
| PubChem CID | 11668 |
|---|---|
| CAS | 594-45-6 |
| Molecular Weight (g/mol) | 109.12 |
| ChEBI | CHEBI:42465 |
| MDL Number | MFCD00007529 |
| SMILES | CCS([O-])(=O)=O |
| Synonym | ethylsulfonic acid,ethanesulphonic acid,ethane sulfonate,ethane sulfonic acid,ethane sulphonic acid,ethansulfonic acid,ethylsulphonic acid,1-ethanesulfonic acid,2-ethanesulfonic acid,ethanesulfonicacid |
| IUPAC Name | ethanesulfonic acid |
| InChI Key | CCIVGXIOQKPBKL-UHFFFAOYSA-M |
| Molecular Formula | C2H5O3S |
Piperazine, anhydrous, 99%
CAS: 110-85-0 Molecular Formula: C4H10N2 Molecular Weight (g/mol): 86.14 MDL Number: MFCD00005953 InChI Key: GLUUGHFHXGJENI-UHFFFAOYSA-N Synonym: diethylenediamine,piperazin,1,4-diazacyclohexane,hexahydropyrazine,piperazidine,antiren,1,4-piperazine,diethyleneimine,eraverm,pipersol PubChem CID: 4837 ChEBI: CHEBI:28568 IUPAC Name: piperazine SMILES: C1CNCCN1
| PubChem CID | 4837 |
|---|---|
| CAS | 110-85-0 |
| Molecular Weight (g/mol) | 86.14 |
| ChEBI | CHEBI:28568 |
| MDL Number | MFCD00005953 |
| SMILES | C1CNCCN1 |
| Synonym | diethylenediamine,piperazin,1,4-diazacyclohexane,hexahydropyrazine,piperazidine,antiren,1,4-piperazine,diethyleneimine,eraverm,pipersol |
| IUPAC Name | piperazine |
| InChI Key | GLUUGHFHXGJENI-UHFFFAOYSA-N |
| Molecular Formula | C4H10N2 |
Calcium D-gluconate gel, 2.5% w/w aq. soln.
CAS: 299-28-5 Molecular Formula: C12H22CaO14 Molecular Weight (g/mol): 430.372 MDL Number: MFCD00064209 InChI Key: NEEHYRZPVYRGPP-IYEMJOQQSA-L Synonym: calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal PubChem CID: 9290 IUPAC Name: calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2]
| PubChem CID | 9290 |
|---|---|
| CAS | 299-28-5 |
| Molecular Weight (g/mol) | 430.372 |
| MDL Number | MFCD00064209 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| Synonym | calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal |
| IUPAC Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | NEEHYRZPVYRGPP-IYEMJOQQSA-L |
| Molecular Formula | C12H22CaO14 |
Benzamide, 99%
CAS: 55-21-0 Molecular Formula: C7H7NO Molecular Weight (g/mol): 121.14 MDL Number: MFCD00007968 InChI Key: KXDAEFPNCMNJSK-UHFFFAOYSA-N Synonym: benzoic acid amide,benzoylamide,phenylcarboxyamide,phenylcarboxamide,benzenecarboxamide,amid kyseliny benzoove,amid kyseliny benzoove czech,phenyl carboxyamide,ccris 4594,benzoic acid,amide PubChem CID: 2331 ChEBI: CHEBI:28179 IUPAC Name: benzamide SMILES: C1=CC=C(C=C1)C(=O)N
| PubChem CID | 2331 |
|---|---|
| CAS | 55-21-0 |
| Molecular Weight (g/mol) | 121.14 |
| ChEBI | CHEBI:28179 |
| MDL Number | MFCD00007968 |
| SMILES | C1=CC=C(C=C1)C(=O)N |
| Synonym | benzoic acid amide,benzoylamide,phenylcarboxyamide,phenylcarboxamide,benzenecarboxamide,amid kyseliny benzoove,amid kyseliny benzoove czech,phenyl carboxyamide,ccris 4594,benzoic acid,amide |
| IUPAC Name | benzamide |
| InChI Key | KXDAEFPNCMNJSK-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO |
Poly(vinyl alcohol), 88% hydrolyzed, average M.W. 20000-30000
CAS: 9002-89-5 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 44.05 MDL Number: MFCD00081922 InChI Key: IMROMDMJAWUWLK-UHFFFAOYSA-N Synonym: vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval PubChem CID: 11199 IUPAC Name: ethenol SMILES: OC(-*)C-*
| PubChem CID | 11199 |
|---|---|
| CAS | 9002-89-5 |
| Molecular Weight (g/mol) | 44.05 |
| MDL Number | MFCD00081922 |
| SMILES | OC(-*)C-* |
| Synonym | vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval |
| IUPAC Name | ethenol |
| InChI Key | IMROMDMJAWUWLK-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Ethyl trifluoroacetate, 99%
CAS: 383-63-1 Molecular Formula: C4H5F3O2 Molecular Weight (g/mol): 142.08 MDL Number: MFCD00000419 InChI Key: STSCVKRWJPWALQ-UHFFFAOYSA-N Synonym: ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid PubChem CID: 9794 IUPAC Name: ethyl 2,2,2-trifluoroacetate SMILES: CCOC(=O)C(F)(F)F
| PubChem CID | 9794 |
|---|---|
| CAS | 383-63-1 |
| Molecular Weight (g/mol) | 142.08 |
| MDL Number | MFCD00000419 |
| SMILES | CCOC(=O)C(F)(F)F |
| Synonym | ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid |
| IUPAC Name | ethyl 2,2,2-trifluoroacetate |
| InChI Key | STSCVKRWJPWALQ-UHFFFAOYSA-N |
| Molecular Formula | C4H5F3O2 |
Biuret, 97%
CAS: 108-19-0 Molecular Formula: C2H5N3O2 MDL Number: MFCD00007946 InChI Key: OHJMTUPIZMNBFR-UHFFFAOYSA-N Synonym: biuret,allophanamide,imidodicarbonic diamide,carbamylurea,ureidoformamide,dicarbonimidic diamide,allophanic acid amide,allophanimidic acid,dicarbamylamine,isobiuret PubChem CID: 7913 ChEBI: CHEBI:18138 IUPAC Name: carbamoylurea
| PubChem CID | 7913 |
|---|---|
| CAS | 108-19-0 |
| ChEBI | CHEBI:18138 |
| MDL Number | MFCD00007946 |
| Synonym | biuret,allophanamide,imidodicarbonic diamide,carbamylurea,ureidoformamide,dicarbonimidic diamide,allophanic acid amide,allophanimidic acid,dicarbamylamine,isobiuret |
| IUPAC Name | carbamoylurea |
| InChI Key | OHJMTUPIZMNBFR-UHFFFAOYSA-N |
| Molecular Formula | C2H5N3O2 |
4-Hydroxybenzoic Acid, 99+%
CAS: 99-96-7 Molecular Formula: C7H6O3 Molecular Weight (g/mol): 138.12 MDL Number: MFCD00002547 InChI Key: FJKROLUGYXJWQN-UHFFFAOYSA-N Synonym: p-hydroxybenzoic acid,4-carboxyphenol,benzoic acid, 4-hydroxy,p-salicylic acid,benzoic acid, p-hydroxy,para-hydroxybenzoic acid,4-hydroxybenzoesaeure,p-carboxyphenol,4-hydroxy benzoic acid,p-oxybenzoesaure german PubChem CID: 135 ChEBI: CHEBI:30763 IUPAC Name: 4-hydroxybenzoic acid SMILES: OC(=O)C1=CC=C(O)C=C1
| PubChem CID | 135 |
|---|---|
| CAS | 99-96-7 |
| Molecular Weight (g/mol) | 138.12 |
| ChEBI | CHEBI:30763 |
| MDL Number | MFCD00002547 |
| SMILES | OC(=O)C1=CC=C(O)C=C1 |
| Synonym | p-hydroxybenzoic acid,4-carboxyphenol,benzoic acid, 4-hydroxy,p-salicylic acid,benzoic acid, p-hydroxy,para-hydroxybenzoic acid,4-hydroxybenzoesaeure,p-carboxyphenol,4-hydroxy benzoic acid,p-oxybenzoesaure german |
| IUPAC Name | 4-hydroxybenzoic acid |
| InChI Key | FJKROLUGYXJWQN-UHFFFAOYSA-N |
| Molecular Formula | C7H6O3 |
| CAS | 58856-93-2 |
|---|---|
| MDL Number | MFCD00082157 |
Tri-n-octylphosphine, tech. 90%
CAS: 4731-53-7 Molecular Formula: C24H51P Molecular Weight (g/mol): 370.646 MDL Number: MFCD00015298 InChI Key: RMZAYIKUYWXQPB-UHFFFAOYSA-N Synonym: trioctylphosphine,tri-n-octylphosphine,phosphine, trioctyl,tri-n-octyl phosphine,tri-octylphosphine,trioctyl phosphine,tri degrees ctylphosphine,acmc-209k8q PubChem CID: 20851 IUPAC Name: trioctylphosphane SMILES: CCCCCCCCP(CCCCCCCC)CCCCCCCC
| PubChem CID | 20851 |
|---|---|
| CAS | 4731-53-7 |
| Molecular Weight (g/mol) | 370.646 |
| MDL Number | MFCD00015298 |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC |
| Synonym | trioctylphosphine,tri-n-octylphosphine,phosphine, trioctyl,tri-n-octyl phosphine,tri-octylphosphine,trioctyl phosphine,tri degrees ctylphosphine,acmc-209k8q |
| IUPAC Name | trioctylphosphane |
| InChI Key | RMZAYIKUYWXQPB-UHFFFAOYSA-N |
| Molecular Formula | C24H51P |
1,3-Diaminopropane, 98%
CAS: 109-76-2 Molecular Formula: C3H10N2 Molecular Weight (g/mol): 74.127 MDL Number: MFCD00008228 InChI Key: XFNJVJPLKCPIBV-UHFFFAOYSA-N Synonym: 1,3-diaminopropane,1,3-propanediamine,trimethylenediamine,1,3-propylenediamine,propandiamine,alpha,omega-propanediamine,unii-cb3isl56kg,ccris 4054,1,3-propane diamine,cb3isl56kg PubChem CID: 428 ChEBI: CHEBI:15725 IUPAC Name: propane-1,3-diamine SMILES: C(CN)CN
| PubChem CID | 428 |
|---|---|
| CAS | 109-76-2 |
| Molecular Weight (g/mol) | 74.127 |
| ChEBI | CHEBI:15725 |
| MDL Number | MFCD00008228 |
| SMILES | C(CN)CN |
| Synonym | 1,3-diaminopropane,1,3-propanediamine,trimethylenediamine,1,3-propylenediamine,propandiamine,alpha,omega-propanediamine,unii-cb3isl56kg,ccris 4054,1,3-propane diamine,cb3isl56kg |
| IUPAC Name | propane-1,3-diamine |
| InChI Key | XFNJVJPLKCPIBV-UHFFFAOYSA-N |
| Molecular Formula | C3H10N2 |